C21H21NO6 — CID 4914850
2-(8-methoxy-6-oxobenzo[c]chromen-3-yl)oxy-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 4914850) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-(8-methoxy-6-oxobenzo[c]chromen-3-yl)oxy-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(8-methoxy-6-oxobenzo[c]chromen-3-yl)oxy-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4914850 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-(8-methoxy-6-oxobenzo[c]chromen-3-yl)oxy-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccc2c(c1)c(=O)oc1cc(OCC(=O)NCC3CCCO3)ccc12 |
| InChI | InChI=1S/C21H21NO6/c1-25-13-4-6-16-17-7-5-14(10-19(17)28-21(24)18(16)9-13)27-12-20(23)22-11-15-3-2-8-26-15/h4-7,9-10,15H,2-3,8,11-12H2,1H3,(H,22,23) |
| InChIKey | IMYHLAJKIGQNII-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'coumarin_A(2)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|