C15H19NO5 — CID 4129063
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-methoxybenzoate (PubChem CID 4129063) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-methoxybenzoate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 4129063 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C15H19NO5/c1-19-12-6-4-11(5-7-12)15(18)21-10-14(17)16-9-13-3-2-8-20-13/h4-7,13H,2-3,8-10H2,1H3,(H,16,17) |
| InChIKey | KIRFSUJELBDLPR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |