C13H16N2O4 — CID 7783951
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] pyridine-4-carboxylate (PubChem CID 7783951) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] pyridine-4-carboxylate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 7783951 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] pyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1ccncc1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H16N2O4/c16-12(15-8-11-2-1-7-18-11)9-19-13(17)10-3-5-14-6-4-10/h3-6,11H,1-2,7-9H2,(H,15,16)/t11-/m0/s1 |
| InChIKey | DWAUFNQNFCQYGG-NSHDSACASA-N |
| XLogP | 0.53 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |