C25H27NO5 — CID 172658899
2-[6-(2,6-dimethoxyphenyl)naphthalen-2-yl]oxy-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 172658899) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-[6-(2,6-dimethoxyphenyl)naphthalen-2-yl]oxy-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[6-(2,6-dimethoxyphenyl)naphthalen-2-yl]oxy-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 172658899 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[6-(2,6-dimethoxyphenyl)naphthalen-2-yl]oxy-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1cccc(OC)c1-c1ccc2cc(OCC(=O)NCC3CCCO3)ccc2c1 |
| InChI | InChI=1S/C25H27NO5/c1-28-22-6-3-7-23(29-2)25(22)19-9-8-18-14-20(11-10-17(18)13-19)31-16-24(27)26-15-21-5-4-12-30-21/h3,6-11,13-14,21H,4-5,12,15-16H2,1-2H3,(H,26,27) |
| InChIKey | WKPZIIYNOKBASW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |