C24H25NO7 — CID 163091491
2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 163091491) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 163091491 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1cccc(C=C2Oc3cc(OCC(=O)NCC4CCCO4)ccc3C2=O)c1OC |
| InChI | InChI=1S/C24H25NO7/c1-28-19-7-3-5-15(24(19)29-2)11-21-23(27)18-9-8-16(12-20(18)32-21)31-14-22(26)25-13-17-6-4-10-30-17/h3,5,7-9,11-12,17H,4,6,10,13-14H2,1-2H3,(H,25,26) |
| InChIKey | FPTZIAYUCURKMD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|