C17H20O5 — CID 883280
tert-butyl 2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 883280) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is tert-butyl 2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | tert-butyl 2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 883280 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | tert-butyl 2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1c(C)c2ccc(OCC(=O)OC(C)(C)C)cc2oc1=O |
| InChI | InChI=1S/C17H20O5/c1-10-11(2)16(19)21-14-8-12(6-7-13(10)14)20-9-15(18)22-17(3,4)5/h6-8H,9H2,1-5H3 |
| InChIKey | AWMSZYFMBRAXKK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|