C19H18O4 — CID 11843295
3,4-dimethyl-7-(2-phenoxyethoxy)chromen-2-one (PubChem CID 11843295) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3,4-dimethyl-7-(2-phenoxyethoxy)chromen-2-one.
| Compound Name | 3,4-dimethyl-7-(2-phenoxyethoxy)chromen-2-one |
|---|---|
| PubChem CID | 11843295 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3,4-dimethyl-7-(2-phenoxyethoxy)chromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCCOc3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C19H18O4/c1-13-14(2)19(20)23-18-12-16(8-9-17(13)18)22-11-10-21-15-6-4-3-5-7-15/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | HVTYBWMEWGLZDS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|