C19H16O5 — CID 906268
(2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid (PubChem CID 906268) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid.
| Compound Name | (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 906268 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid |
| SMILES | Cc1c(C)c2ccc(O[C@@H](C(=O)O)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C19H16O5/c1-11-12(2)19(22)24-16-10-14(8-9-15(11)16)23-17(18(20)21)13-6-4-3-5-7-13/h3-10,17H,1-2H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | OKVOMJFQVVOHNW-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|