(2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid

C19H16O5 — CID 906268

IUPAC(2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid
SMILESCc1c(C)c2ccc(O[C@@H](C(=O)O)c3ccccc3)cc2oc1=O
InChIInChI=1S/C19H16O5/c1-11-12(2)19(22)24-16-10-14(8-9-15(11)16)23-17(18(20)21)13-6-4-3-5-7-13/h3-10,17H,1-2H3,(H,20,21)/t17-/m1/s1
InChIKeyOKVOMJFQVVOHNW-QGZVFWFLSA-N
MW324.33 g/mol
LogP3.61
Rot. Bonds4

About (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid

(2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid (PubChem CID 906268) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid.

Molecular Properties

Compound Name(2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid
PubChem CID906268
Molecular FormulaC19H16O5
Molecular Weight324.33 g/mol
Exact Mass324.10
IUPAC Name(2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid
SMILESCc1c(C)c2ccc(O[C@@H](C(=O)O)c3ccccc3)cc2oc1=O
InChIInChI=1S/C19H16O5/c1-11-12(2)19(22)24-16-10-14(8-9-15(11)16)23-17(18(20)21)13-6-4-3-5-7-13/h3-10,17H,1-2H3,(H,20,21)/t17-/m1/s1
InChIKeyOKVOMJFQVVOHNW-QGZVFWFLSA-N
XLogP3.61
TPSA76.74 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.33
LogP ≤ 53.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid?
The IUPAC name of (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid (CID 906268) is (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid.
What is the SMILES notation for (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid?
The canonical SMILES for (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid is Cc1c(C)c2ccc(O[C@@H](C(=O)O)c3ccccc3)cc2oc1=O.
What is the InChIKey of (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid?
The InChIKey is OKVOMJFQVVOHNW-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H16O5/c1-11-12(2)19(22)24-16-10-14(8-9-15(11)16)23-17(18(20)21)13-6-4-3-5-7-13/h3-10,17H,1-2H3,(H,20,21)/t17-/m1/s1.
What are the key properties of (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid?
(2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid has a molecular weight of 324.33 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-2-phenylacetic acid is sourced from PubChem (CID 906268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).