C24H18O4 — CID 2955979
4-methyl-7-(2-oxo-1,2-diphenylethoxy)chromen-2-one (PubChem CID 2955979) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is 4-methyl-7-(2-oxo-1,2-diphenylethoxy)chromen-2-one.
| Compound Name | 4-methyl-7-(2-oxo-1,2-diphenylethoxy)chromen-2-one |
|---|---|
| PubChem CID | 2955979 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-methyl-7-(2-oxo-1,2-diphenylethoxy)chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OC(C(=O)c3ccccc3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C24H18O4/c1-16-14-22(25)28-21-15-19(12-13-20(16)21)27-24(18-10-6-3-7-11-18)23(26)17-8-4-2-5-9-17/h2-15,24H,1H3 |
| InChIKey | XLGCNYXFXGFCDE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|