C24H18O4 — CID 983535
(4-methyl-2-oxochromen-7-yl) 2,2-diphenylacetate (PubChem CID 983535) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 2,2-diphenylacetate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 2,2-diphenylacetate |
|---|---|
| PubChem CID | 983535 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 2,2-diphenylacetate |
| SMILES | Cc1cc(=O)oc2cc(OC(=O)C(c3ccccc3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C24H18O4/c1-16-14-22(25)28-21-15-19(12-13-20(16)21)27-24(26)23(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15,23H,1H3 |
| InChIKey | RLGNILMIMTUEQG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|