C20H16O5 — CID 705666
(2S)-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-2-phenylacetic acid (PubChem CID 705666) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is (2S)-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-2-phenylacetic acid |
|---|---|
| PubChem CID | 705666 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (2S)-2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-2-phenylacetic acid |
| SMILES | O=C(O)[C@@H](Oc1ccc2c3c(c(=O)oc2c1)CCC3)c1ccccc1 |
| InChI | InChI=1S/C20H16O5/c21-19(22)18(12-5-2-1-3-6-12)24-13-9-10-15-14-7-4-8-16(14)20(23)25-17(15)11-13/h1-3,5-6,9-11,18H,4,7-8H2,(H,21,22)/t18-/m0/s1 |
| InChIKey | VTULPAQMHCOZTG-SFHVURJKSA-N |
| XLogP | 3.49 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|