C22H20O6 — CID 40545307
(2R)-2-[(3-methoxy-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-4-yl)oxy]-2-phenylacetic acid (PubChem CID 40545307) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is (2R)-2-[(3-methoxy-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-4-yl)oxy]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(3-methoxy-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-4-yl)oxy]-2-phenylacetic acid |
|---|---|
| PubChem CID | 40545307 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2R)-2-[(3-methoxy-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-4-yl)oxy]-2-phenylacetic acid |
| SMILES | COc1ccc2c3c(c(=O)oc2c1O[C@@H](C(=O)O)c1ccccc1)CCCC3 |
| InChI | InChI=1S/C22H20O6/c1-26-17-12-11-15-14-9-5-6-10-16(14)22(25)28-19(15)20(17)27-18(21(23)24)13-7-3-2-4-8-13/h2-4,7-8,11-12,18H,5-6,9-10H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | AAVOLAGLUBQSRJ-GOSISDBHSA-N |
| XLogP | 3.89 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|