C18H15FO3 — CID 744840
7-[(2-fluorophenyl)methoxy]-3,4-dimethylchromen-2-one (PubChem CID 744840) has the molecular formula C18H15FO3 and a molecular weight of 298.31 g/mol. Its IUPAC name is 7-[(2-fluorophenyl)methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[(2-fluorophenyl)methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 744840 |
| Molecular Formula | C18H15FO3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 7-[(2-fluorophenyl)methoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCc3ccccc3F)cc2oc1=O |
| InChI | InChI=1S/C18H15FO3/c1-11-12(2)18(20)22-17-9-14(7-8-15(11)17)21-10-13-5-3-4-6-16(13)19/h3-9H,10H2,1-2H3 |
| InChIKey | BWVRKJLXVDNYTA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|