C16H18O5 — CID 882841
propan-2-yl 2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 882841) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is propan-2-yl 2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | propan-2-yl 2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 882841 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | propan-2-yl 2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1c(C)c2ccc(OCC(=O)OC(C)C)cc2oc1=O |
| InChI | InChI=1S/C16H18O5/c1-9(2)20-15(17)8-19-12-5-6-13-10(3)11(4)16(18)21-14(13)7-12/h5-7,9H,8H2,1-4H3 |
| InChIKey | CJZDQSZLXWANSR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|