C22H19NO8 — CID 124931882
(2R)-2-[[2-[4-(1-oxoisochromen-3-yl)phenoxy]acetyl]amino]pentanedioic acid (PubChem CID 124931882) has the molecular formula C22H19NO8 and a molecular weight of 425.39 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(1-oxoisochromen-3-yl)phenoxy]acetyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[2-[4-(1-oxoisochromen-3-yl)phenoxy]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 124931882 |
| Molecular Formula | C22H19NO8 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (2R)-2-[[2-[4-(1-oxoisochromen-3-yl)phenoxy]acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](NC(=O)COc1ccc(-c2cc3ccccc3c(=O)o2)cc1)C(=O)O |
| InChI | InChI=1S/C22H19NO8/c24-19(23-17(21(27)28)9-10-20(25)26)12-30-15-7-5-13(6-8-15)18-11-14-3-1-2-4-16(14)22(29)31-18/h1-8,11,17H,9-10,12H2,(H,23,24)(H,25,26)(H,27,28)/t17-/m1/s1 |
| InChIKey | QTKNOJKBCBQEIX-QGZVFWFLSA-N |
| XLogP | 2.27 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |