C21H17NO8 — CID 124931731
(2R)-2-[[2-[4-(1-oxoisochromen-3-yl)phenoxy]acetyl]amino]butanedioic acid (PubChem CID 124931731) has the molecular formula C21H17NO8 and a molecular weight of 411.37 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(1-oxoisochromen-3-yl)phenoxy]acetyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[2-[4-(1-oxoisochromen-3-yl)phenoxy]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 124931731 |
| Molecular Formula | C21H17NO8 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (2R)-2-[[2-[4-(1-oxoisochromen-3-yl)phenoxy]acetyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)COc1ccc(-c2cc3ccccc3c(=O)o2)cc1)C(=O)O |
| InChI | InChI=1S/C21H17NO8/c23-18(22-16(20(26)27)10-19(24)25)11-29-14-7-5-12(6-8-14)17-9-13-3-1-2-4-15(13)21(28)30-17/h1-9,16H,10-11H2,(H,22,23)(H,24,25)(H,26,27)/t16-/m1/s1 |
| InChIKey | GVFPXESCNYPCIK-MRXNPFEDSA-N |
| XLogP | 1.88 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |