C26H22N2O4 — CID 4512962
N'-(2-naphthalen-2-yloxyacetyl)-2-(4-phenylphenoxy)acetohydrazide (PubChem CID 4512962) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is N'-(2-naphthalen-2-yloxyacetyl)-2-(4-phenylphenoxy)acetohydrazide.
| Compound Name | N'-(2-naphthalen-2-yloxyacetyl)-2-(4-phenylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 4512962 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N'-(2-naphthalen-2-yloxyacetyl)-2-(4-phenylphenoxy)acetohydrazide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)NNC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H22N2O4/c29-25(17-31-23-13-10-21(11-14-23)19-6-2-1-3-7-19)27-28-26(30)18-32-24-15-12-20-8-4-5-9-22(20)16-24/h1-16H,17-18H2,(H,27,29)(H,28,30) |
| InChIKey | FZTTVCOICRYGDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|