C26H22N2O3 — CID 4513399
2-naphthalen-1-yl-N'-[2-(4-phenylphenoxy)acetyl]acetohydrazide (PubChem CID 4513399) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N'-[2-(4-phenylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-naphthalen-1-yl-N'-[2-(4-phenylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 4513399 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-naphthalen-1-yl-N'-[2-(4-phenylphenoxy)acetyl]acetohydrazide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C26H22N2O3/c29-25(17-22-11-6-10-21-9-4-5-12-24(21)22)27-28-26(30)18-31-23-15-13-20(14-16-23)19-7-2-1-3-8-19/h1-16H,17-18H2,(H,27,29)(H,28,30) |
| InChIKey | FCRJTDDRKAWDNO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|