C20H19NO5 — CID 51808629
N-[(2R)-1-hydroxypropan-2-yl]-2-[4-(2-oxochromen-3-yl)phenoxy]acetamide (PubChem CID 51808629) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is N-[(2R)-1-hydroxypropan-2-yl]-2-[4-(2-oxochromen-3-yl)phenoxy]acetamide.
| Compound Name | N-[(2R)-1-hydroxypropan-2-yl]-2-[4-(2-oxochromen-3-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 51808629 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[(2R)-1-hydroxypropan-2-yl]-2-[4-(2-oxochromen-3-yl)phenoxy]acetamide |
| SMILES | C[C@H](CO)NC(=O)COc1ccc(-c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C20H19NO5/c1-13(11-22)21-19(23)12-25-16-8-6-14(7-9-16)17-10-15-4-2-3-5-18(15)26-20(17)24/h2-10,13,22H,11-12H2,1H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | MWKDAISBDAMQSS-CYBMUJFWSA-N |
| XLogP | 2.34 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|