C24H18ClNO4 — CID 23966257
2-(4-chloro-3-methylphenoxy)-N-[4-(2-oxochromen-3-yl)phenyl]acetamide (PubChem CID 23966257) has the molecular formula C24H18ClNO4 and a molecular weight of 419.86 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[4-(2-oxochromen-3-yl)phenyl]acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[4-(2-oxochromen-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 23966257 |
| Molecular Formula | C24H18ClNO4 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[4-(2-oxochromen-3-yl)phenyl]acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc(-c3cc4ccccc4oc3=O)cc2)ccc1Cl |
| InChI | InChI=1S/C24H18ClNO4/c1-15-12-19(10-11-21(15)25)29-14-23(27)26-18-8-6-16(7-9-18)20-13-17-4-2-3-5-22(17)30-24(20)28/h2-13H,14H2,1H3,(H,26,27) |
| InChIKey | TTWLAIOYWPBPRL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|