C21H18N2O7S — CID 71536965
2-[[2-[4-(4-isothiocyanatobenzoyl)phenoxy]acetyl]amino]pentanedioic acid (PubChem CID 71536965) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is 2-[[2-[4-(4-isothiocyanatobenzoyl)phenoxy]acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[4-(4-isothiocyanatobenzoyl)phenoxy]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 71536965 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[[2-[4-(4-isothiocyanatobenzoyl)phenoxy]acetyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)COc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H18N2O7S/c24-18(23-17(21(28)29)9-10-19(25)26)11-30-16-7-3-14(4-8-16)20(27)13-1-5-15(6-2-13)22-12-31/h1-8,17H,9-11H2,(H,23,24)(H,25,26)(H,28,29) |
| InChIKey | VKNRPUDTHCGDAR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|