C23H27N5O6 — CID 58071578
5-amino-2-[3-[4-[4-(dimethylaminodiazenyl)benzoyl]phenoxy]propanoylamino]-5-oxopentanoic acid (PubChem CID 58071578) has the molecular formula C23H27N5O6 and a molecular weight of 469.50 g/mol. Its IUPAC name is 5-amino-2-[3-[4-[4-(dimethylaminodiazenyl)benzoyl]phenoxy]propanoylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[3-[4-[4-(dimethylaminodiazenyl)benzoyl]phenoxy]propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 58071578 |
| Molecular Formula | C23H27N5O6 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 5-amino-2-[3-[4-[4-(dimethylaminodiazenyl)benzoyl]phenoxy]propanoylamino]-5-oxopentanoic acid |
| SMILES | CN(C)/N=N/c1ccc(C(=O)c2ccc(OCCC(=O)NC(CCC(N)=O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H27N5O6/c1-28(2)27-26-17-7-3-15(4-8-17)22(31)16-5-9-18(10-6-16)34-14-13-21(30)25-19(23(32)33)11-12-20(24)29/h3-10,19H,11-14H2,1-2H3,(H2,24,29)(H,25,30)(H,32,33)/b27-26+ |
| InChIKey | IIFPJDUHVBHHKK-CYYJNZCTSA-N |
| XLogP | 2.08 |
| TPSA | 163.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|