C22H23N3O7 — CID 58071579
2-[3-[4-[4-(dimethylaminodiazenyl)benzoyl]phenoxy]-2-oxopropyl]butanedioic acid (PubChem CID 58071579) has the molecular formula C22H23N3O7 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-[3-[4-[4-(dimethylaminodiazenyl)benzoyl]phenoxy]-2-oxopropyl]butanedioic acid.
| Compound Name | 2-[3-[4-[4-(dimethylaminodiazenyl)benzoyl]phenoxy]-2-oxopropyl]butanedioic acid |
|---|---|
| PubChem CID | 58071579 |
| Molecular Formula | C22H23N3O7 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[3-[4-[4-(dimethylaminodiazenyl)benzoyl]phenoxy]-2-oxopropyl]butanedioic acid |
| SMILES | CN(C)/N=N/c1ccc(C(=O)c2ccc(OCC(=O)CC(CC(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O7/c1-25(2)24-23-17-7-3-14(4-8-17)21(29)15-5-9-19(10-6-15)32-13-18(26)11-16(22(30)31)12-20(27)28/h3-10,16H,11-13H2,1-2H3,(H,27,28)(H,30,31)/b24-23+ |
| InChIKey | PCYMFUZXFZIXOS-WCWDXBQESA-N |
| XLogP | 2.99 |
| TPSA | 145.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|