C25H25NO7S — CID 123237285
2-[7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptyl]butanedioic acid (PubChem CID 123237285) has the molecular formula C25H25NO7S and a molecular weight of 483.54 g/mol. Its IUPAC name is 2-[7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptyl]butanedioic acid.
| Compound Name | 2-[7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptyl]butanedioic acid |
|---|---|
| PubChem CID | 123237285 |
| Molecular Formula | C25H25NO7S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-[7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptyl]butanedioic acid |
| SMILES | O=C(O)CC(CCCC(=O)CCCOc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H25NO7S/c27-21(4-1-3-19(25(31)32)15-23(28)29)5-2-14-33-22-12-8-18(9-13-22)24(30)17-6-10-20(11-7-17)26-16-34/h6-13,19H,1-5,14-15H2,(H,28,29)(H,31,32) |
| InChIKey | AQDNXZMMZSZNBU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|