C21H19NO5S — CID 157205772
7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanoic acid (PubChem CID 157205772) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanoic acid.
| Compound Name | 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 157205772 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanoic acid |
| SMILES | O=C(O)CCC(=O)CCCOc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C21H19NO5S/c23-18(9-12-20(24)25)2-1-13-27-19-10-5-16(6-11-19)21(26)15-3-7-17(8-4-15)22-14-28/h3-8,10-11H,1-2,9,12-13H2,(H,24,25) |
| InChIKey | KWRHOFYIDLJEIA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|