C19H17NO7S — CID 157319658
5-[4-(4-isocyanatobenzoyl)phenoxy]-4-oxopentane-1-sulfonic acid (PubChem CID 157319658) has the molecular formula C19H17NO7S and a molecular weight of 403.41 g/mol. Its IUPAC name is 5-[4-(4-isocyanatobenzoyl)phenoxy]-4-oxopentane-1-sulfonic acid.
| Compound Name | 5-[4-(4-isocyanatobenzoyl)phenoxy]-4-oxopentane-1-sulfonic acid |
|---|---|
| PubChem CID | 157319658 |
| Molecular Formula | C19H17NO7S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 5-[4-(4-isocyanatobenzoyl)phenoxy]-4-oxopentane-1-sulfonic acid |
| SMILES | O=C=Nc1ccc(C(=O)c2ccc(OCC(=O)CCCS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H17NO7S/c21-13-20-16-7-3-14(4-8-16)19(23)15-5-9-18(10-6-15)27-12-17(22)2-1-11-28(24,25)26/h3-10H,1-2,11-12H2,(H,24,25,26) |
| InChIKey | OCHYLZKCHBKWGY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|