C22H21NO5S — CID 152891758
methyl 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanoate (PubChem CID 152891758) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is methyl 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanoate.
| Compound Name | methyl 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanoate |
|---|---|
| PubChem CID | 152891758 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | methyl 7-[4-(4-isothiocyanatobenzoyl)phenoxy]-4-oxoheptanoate |
| SMILES | COC(=O)CCC(=O)CCCOc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C22H21NO5S/c1-27-21(25)13-10-19(24)3-2-14-28-20-11-6-17(7-12-20)22(26)16-4-8-18(9-5-16)23-15-29/h4-9,11-12H,2-3,10,13-14H2,1H3 |
| InChIKey | UDOUSRRRFCGZJV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|