C19H17NO4S — CID 71538377
methyl 3-[4-(4-isothiocyanatobenzoyl)phenoxy]butanoate (PubChem CID 71538377) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl 3-[4-(4-isothiocyanatobenzoyl)phenoxy]butanoate.
| Compound Name | methyl 3-[4-(4-isothiocyanatobenzoyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 71538377 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | methyl 3-[4-(4-isothiocyanatobenzoyl)phenoxy]butanoate |
| SMILES | COC(=O)CC(C)Oc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C19H17NO4S/c1-13(11-18(21)23-2)24-17-9-5-15(6-10-17)19(22)14-3-7-16(8-4-14)20-12-25/h3-10,13H,11H2,1-2H3 |
| InChIKey | XFAPAHSMJHHCKF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|