C23H23N3O6S — CID 89471609
5-amino-2-[3-[4-(4-isothiocyanatobenzoyl)phenoxy]butanoylamino]-5-oxopentanoic acid (PubChem CID 89471609) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is 5-amino-2-[3-[4-(4-isothiocyanatobenzoyl)phenoxy]butanoylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[3-[4-(4-isothiocyanatobenzoyl)phenoxy]butanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 89471609 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 5-amino-2-[3-[4-(4-isothiocyanatobenzoyl)phenoxy]butanoylamino]-5-oxopentanoic acid |
| SMILES | CC(CC(=O)NC(CCC(N)=O)C(=O)O)Oc1ccc(C(=O)c2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O6S/c1-14(12-21(28)26-19(23(30)31)10-11-20(24)27)32-18-8-4-16(5-9-18)22(29)15-2-6-17(7-3-15)25-13-33/h2-9,14,19H,10-12H2,1H3,(H2,24,27)(H,26,28)(H,30,31) |
| InChIKey | JASVYFFASHMKJS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|