C15H20N2O4 — CID 107829986
(2R)-5-amino-2-[[2-(2,5-dimethylphenyl)acetyl]amino]-5-oxopentanoic acid (PubChem CID 107829986) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2R)-5-amino-2-[[2-(2,5-dimethylphenyl)acetyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[[2-(2,5-dimethylphenyl)acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829986 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (2R)-5-amino-2-[[2-(2,5-dimethylphenyl)acetyl]amino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(C)c(CC(=O)N[C@H](CCC(N)=O)C(=O)O)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-9-3-4-10(2)11(7-9)8-14(19)17-12(15(20)21)5-6-13(16)18/h3-4,7,12H,5-6,8H2,1-2H3,(H2,16,18)(H,17,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | WUTUMCYTESBIQI-GFCCVEGCSA-N |
| XLogP | 0.68 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |