C15H20N2O5 — CID 108789938
5-amino-2-[3-(4-methylphenoxy)propanoylamino]-5-oxopentanoic acid (PubChem CID 108789938) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-amino-2-[3-(4-methylphenoxy)propanoylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[3-(4-methylphenoxy)propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 108789938 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-amino-2-[3-(4-methylphenoxy)propanoylamino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(OCCC(=O)NC(CCC(N)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O5/c1-10-2-4-11(5-3-10)22-9-8-14(19)17-12(15(20)21)6-7-13(16)18/h2-5,12H,6-9H2,1H3,(H2,16,18)(H,17,19)(H,20,21) |
| InChIKey | NVSAYZBVZAKDGO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |