C24H24N2O7 — CID 163533837
4-amino-4-oxo-2-[3-[4-[4-(3-oxoprop-2-enyl)benzoyl]phenoxy]butanoylamino]butanoic acid (PubChem CID 163533837) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is 4-amino-4-oxo-2-[3-[4-[4-(3-oxoprop-2-enyl)benzoyl]phenoxy]butanoylamino]butanoic acid.
| Compound Name | 4-amino-4-oxo-2-[3-[4-[4-(3-oxoprop-2-enyl)benzoyl]phenoxy]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 163533837 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-amino-4-oxo-2-[3-[4-[4-(3-oxoprop-2-enyl)benzoyl]phenoxy]butanoylamino]butanoic acid |
| SMILES | CC(CC(=O)NC(CC(N)=O)C(=O)O)Oc1ccc(C(=O)c2ccc(CC=C=O)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O7/c1-15(13-22(29)26-20(24(31)32)14-21(25)28)33-19-10-8-18(9-11-19)23(30)17-6-4-16(5-7-17)3-2-12-27/h2,4-11,15,20H,3,13-14H2,1H3,(H2,25,28)(H,26,29)(H,31,32) |
| InChIKey | DVGRXRJJJNNNHI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|