C14H18N2O5 — CID 61141581
(2S)-4-amino-2-[[2-(4-ethoxyphenyl)acetyl]amino]-4-oxobutanoic acid (PubChem CID 61141581) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2S)-4-amino-2-[[2-(4-ethoxyphenyl)acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[2-(4-ethoxyphenyl)acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 61141581 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2S)-4-amino-2-[[2-(4-ethoxyphenyl)acetyl]amino]-4-oxobutanoic acid |
| SMILES | CCOc1ccc(CC(=O)N[C@@H](CC(N)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O5/c1-2-21-10-5-3-9(4-6-10)7-13(18)16-11(14(19)20)8-12(15)17/h3-6,11H,2,7-8H2,1H3,(H2,15,17)(H,16,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | YXONNYACHWYOGW-NSHDSACASA-N |
| XLogP | 0.07 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |