C8H15N3O4 — CID 103870227
(2R)-4-amino-2-(3-aminobutanoylamino)-4-oxobutanoic acid (PubChem CID 103870227) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is (2R)-4-amino-2-(3-aminobutanoylamino)-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-(3-aminobutanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103870227 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2R)-4-amino-2-(3-aminobutanoylamino)-4-oxobutanoic acid |
| SMILES | CC(N)CC(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H15N3O4/c1-4(9)2-7(13)11-5(8(14)15)3-6(10)12/h4-5H,2-3,9H2,1H3,(H2,10,12)(H,11,13)(H,14,15)/t4?,5-/m1/s1 |
| InChIKey | BKMBNKYGWFHODX-BRJRFNKRSA-N |
| XLogP | -1.83 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |