C12H22N2O4 — CID 55260321
4-amino-4-oxo-2-(3,4,4-trimethylpentanoylamino)butanoic acid (PubChem CID 55260321) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-amino-4-oxo-2-(3,4,4-trimethylpentanoylamino)butanoic acid.
| Compound Name | 4-amino-4-oxo-2-(3,4,4-trimethylpentanoylamino)butanoic acid |
|---|---|
| PubChem CID | 55260321 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 4-amino-4-oxo-2-(3,4,4-trimethylpentanoylamino)butanoic acid |
| SMILES | CC(CC(=O)NC(CC(N)=O)C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H22N2O4/c1-7(12(2,3)4)5-10(16)14-8(11(17)18)6-9(13)15/h7-8H,5-6H2,1-4H3,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | PEJHFJXLCMNHCP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |