C9H16N2O4 — CID 30053119
(2S)-4-amino-2-(2,2-dimethylpropanoylamino)-4-oxobutanoic acid (PubChem CID 30053119) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is (2S)-4-amino-2-(2,2-dimethylpropanoylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-(2,2-dimethylpropanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 30053119 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (2S)-4-amino-2-(2,2-dimethylpropanoylamino)-4-oxobutanoic acid |
| SMILES | CC(C)(C)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H16N2O4/c1-9(2,3)8(15)11-5(7(13)14)4-6(10)12/h5H,4H2,1-3H3,(H2,10,12)(H,11,15)(H,13,14)/t5-/m0/s1 |
| InChIKey | HZPXMMLAPIGSJI-YFKPBYRVSA-N |
| XLogP | -0.52 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |