C9H17N3O4S — CID 175691848
(2S)-4-amino-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-4-oxobutanoic acid (PubChem CID 175691848) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is (2S)-4-amino-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175691848 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (2S)-4-amino-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)(S)[C@H](N)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O4S/c1-9(2,17)6(11)7(14)12-4(8(15)16)3-5(10)13/h4,6,17H,3,11H2,1-2H3,(H2,10,13)(H,12,14)(H,15,16)/t4-,6+/m0/s1 |
| InChIKey | BVOBOUBHEGWRGO-UJURSFKZSA-N |
| XLogP | -1.53 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|