C10H20N2O3S2 — CID 175691591
(2R)-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-3-methyl-3-sulfanylbutanoic acid (PubChem CID 175691591) has the molecular formula C10H20N2O3S2 and a molecular weight of 280.42 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 175691591 |
| Molecular Formula | C10H20N2O3S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (2R)-2-[[(2R)-2-amino-3-methyl-3-sulfanylbutanoyl]amino]-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(S)[C@H](N)C(=O)N[C@H](C(=O)O)C(C)(C)S |
| InChI | InChI=1S/C10H20N2O3S2/c1-9(2,16)5(11)7(13)12-6(8(14)15)10(3,4)17/h5-6,16-17H,11H2,1-4H3,(H,12,13)(H,14,15)/t5-,6-/m1/s1 |
| InChIKey | HQLNPTZQZYLBPI-PHDIDXHHSA-N |
| XLogP | 0.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|