C10H20N2O3S4Se — CID 175963937
(2R)-2-[[(2S)-2-amino-3-methyl-3-sulfanylbutanoyl]sulfanylselanylsulfanylamino]-3-methyl-3-sulfanylbutanoic acid (PubChem CID 175963937) has the molecular formula C10H20N2O3S4Se and a molecular weight of 423.51 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-amino-3-methyl-3-sulfanylbutanoyl]sulfanylselanylsulfanylamino]-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-amino-3-methyl-3-sulfanylbutanoyl]sulfanylselanylsulfanylamino]-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 175963937 |
| Molecular Formula | C10H20N2O3S4Se |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | (2R)-2-[[(2S)-2-amino-3-methyl-3-sulfanylbutanoyl]sulfanylselanylsulfanylamino]-3-methyl-3-sulfanylbutanoic acid |
| SMILES | CC(C)(S)[C@H](N)C(=O)S[Se]SN[C@H](C(=O)O)C(C)(C)S |
| InChI | InChI=1S/C10H20N2O3S4Se/c1-9(2,16)5(11)8(15)18-20-19-12-6(7(13)14)10(3,4)17/h5-6,12,16-17H,11H2,1-4H3,(H,13,14)/t5-,6-/m1/s1 |
| InChIKey | PSPBBYOPYQDBFG-PHDIDXHHSA-N |
| XLogP | 1.22 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|