C5H11NO2S — CID 25240785
(2S,3R)-2-amino-4,4,4-trideuterio-3-methyl-3-sulfanylbutanoic acid (PubChem CID 25240785) has the molecular formula C5H11NO2S and a molecular weight of 152.23 g/mol. Its IUPAC name is (2S,3R)-2-amino-4,4,4-trideuterio-3-methyl-3-sulfanylbutanoic acid.
| Compound Name | (2S,3R)-2-amino-4,4,4-trideuterio-3-methyl-3-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 25240785 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 152.23 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | (2S,3R)-2-amino-4,4,4-trideuterio-3-methyl-3-sulfanylbutanoic acid |
| SMILES | [2H]C([2H])([2H])[C@@](C)(S)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S/c1-5(2,9)3(6)4(7)8/h3,9H,6H2,1-2H3,(H,7,8)/t3-/m0/s1/i1D3/t3-,5- |
| InChIKey | VVNCNSJFMMFHPL-FUIHHJBBSA-N |
| XLogP | 0.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|