C5H11NO2S4Se — CID 88623637
(2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;trithiaselenetane (PubChem CID 88623637) has the molecular formula C5H11NO2S4Se and a molecular weight of 324.38 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;trithiaselenetane.
| Compound Name | (2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;trithiaselenetane |
|---|---|
| PubChem CID | 88623637 |
| Molecular Formula | C5H11NO2S4Se |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.88 |
| IUPAC Name | (2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;trithiaselenetane |
| SMILES | CC(C)(S)[C@H](N)C(=O)O.S1S[Se]S1 |
| InChI | InChI=1S/C5H11NO2S.S3Se/c1-5(2,9)3(6)4(7)8;1-2-4-3-1/h3,9H,6H2,1-2H3,(H,7,8);/t3-;/m1./s1 |
| InChIKey | ACYZAAAKRLTZOJ-AENDTGMFSA-N |
| XLogP | 1.67 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|