C5H11MnNO2S — CID 175737812
(2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;manganese (PubChem CID 175737812) has the molecular formula C5H11MnNO2S and a molecular weight of 204.15 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;manganese.
| Compound Name | (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;manganese |
|---|---|
| PubChem CID | 175737812 |
| Molecular Formula | C5H11MnNO2S |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;manganese |
| SMILES | CC(C)(S)[C@@H](N)C(=O)O.[Mn] |
| InChI | InChI=1S/C5H11NO2S.Mn/c1-5(2,9)3(6)4(7)8;/h3,9H,6H2,1-2H3,(H,7,8);/t3-;/m0./s1 |
| InChIKey | JEOZWPVCRMPJDK-DFWYDOINSA-N |
| XLogP | 0.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|