C10H20N2O6S — CID 87642658
(2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;(2S)-2-aminopentanedioic acid (PubChem CID 87642658) has the molecular formula C10H20N2O6S and a molecular weight of 296.35 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;(2S)-2-aminopentanedioic acid.
| Compound Name | (2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;(2S)-2-aminopentanedioic acid |
|---|---|
| PubChem CID | 87642658 |
| Molecular Formula | C10H20N2O6S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2R)-2-amino-3-methyl-3-sulfanylbutanoic acid;(2S)-2-aminopentanedioic acid |
| SMILES | CC(C)(S)[C@H](N)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C5H11NO2S/c6-3(5(9)10)1-2-4(7)8;1-5(2,9)3(6)4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10);3,9H,6H2,1-2H3,(H,7,8)/t2*3-/m01/s1 |
| InChIKey | HQXVWELHXXYXJB-OCZOEHNFSA-N |
| XLogP | -0.63 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|