C7H15NO2 — CID 162641870
(2S)-2-amino-5,5,5-trideuterio-4,4-dimethylpentanoic acid (PubChem CID 162641870) has the molecular formula C7H15NO2 and a molecular weight of 148.22 g/mol. Its IUPAC name is (2S)-2-amino-5,5,5-trideuterio-4,4-dimethylpentanoic acid.
| Compound Name | (2S)-2-amino-5,5,5-trideuterio-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 162641870 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 148.22 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (2S)-2-amino-5,5,5-trideuterio-4,4-dimethylpentanoic acid |
| SMILES | [2H]C([2H])([2H])C(C)(C)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H15NO2/c1-7(2,3)4-5(8)6(9)10/h5H,4,8H2,1-3H3,(H,9,10)/t5-/m0/s1/i1D3 |
| InChIKey | LPBSHGLDBQBSPI-MQBGRFPLSA-N |
| XLogP | 0.83 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |