2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid

C16H32N2O4 — CID 175070006

IUPAC2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid
SMILESCC(C)(C)CC(N)C(=O)O.NC(CC1CCCCC1)C(=O)O
InChIInChI=1S/C9H17NO2.C7H15NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-7(2,3)4-5(8)6(9)10/h7-8H,1-6,10H2,(H,11,12);5H,4,8H2,1-3H3,(H,9,10)
InChIKeyNMMRJDLDTXBMBG-UHFFFAOYSA-N
MW316.44 g/mol
LogP2.20
Rot. Bonds5

About 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid

2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid (PubChem CID 175070006) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid.

Molecular Properties

Compound Name2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid
PubChem CID175070006
Molecular FormulaC16H32N2O4
Molecular Weight316.44 g/mol
Exact Mass316.24
IUPAC Name2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid
SMILESCC(C)(C)CC(N)C(=O)O.NC(CC1CCCCC1)C(=O)O
InChIInChI=1S/C9H17NO2.C7H15NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-7(2,3)4-5(8)6(9)10/h7-8H,1-6,10H2,(H,11,12);5H,4,8H2,1-3H3,(H,9,10)
InChIKeyNMMRJDLDTXBMBG-UHFFFAOYSA-N
XLogP2.20
TPSA126.64 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.44
LogP ≤ 52.20
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid?
The IUPAC name of 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid (CID 175070006) is 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid.
What is the SMILES notation for 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid?
The canonical SMILES for 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid is CC(C)(C)CC(N)C(=O)O.NC(CC1CCCCC1)C(=O)O.
What is the InChIKey of 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid?
The InChIKey is NMMRJDLDTXBMBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C7H15NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-7(2,3)4-5(8)6(9)10/h7-8H,1-6,10H2,(H,11,12);5H,4,8H2,1-3H3,(H,9,10).
What are the key properties of 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid?
2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid has a molecular weight of 316.44 g/mol, XLogP of 2.20, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid is sourced from PubChem (CID 175070006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).