C16H32N2O4 — CID 175070006
2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid (PubChem CID 175070006) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid.
| Compound Name | 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 175070006 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 2-amino-3-cyclohexylpropanoic acid;2-amino-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(N)C(=O)O.NC(CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C9H17NO2.C7H15NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-7(2,3)4-5(8)6(9)10/h7-8H,1-6,10H2,(H,11,12);5H,4,8H2,1-3H3,(H,9,10) |
| InChIKey | NMMRJDLDTXBMBG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |