About 2-amino-3-cyclohexyl-N,N-dimethylpropanamide
2-amino-3-cyclohexyl-N,N-dimethylpropanamide (PubChem CID 83618462) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-amino-3-cyclohexyl-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-amino-3-cyclohexyl-N,N-dimethylpropanamide |
| PubChem CID | 83618462 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2-amino-3-cyclohexyl-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)C(N)CC1CCCCC1 |
| InChI | InChI=1S/C11H22N2O/c1-13(2)11(14)10(12)8-9-6-4-3-5-7-9/h9-10H,3-8,12H2,1-2H3 |
| InChIKey | UNYPVAVUPQIZTG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-cyclohexyl-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-cyclohexyl-N,N-dimethylpropanamide?
The IUPAC name of 2-amino-3-cyclohexyl-N,N-dimethylpropanamide (CID 83618462) is 2-amino-3-cyclohexyl-N,N-dimethylpropanamide.
What is the SMILES notation for 2-amino-3-cyclohexyl-N,N-dimethylpropanamide?
The canonical SMILES for 2-amino-3-cyclohexyl-N,N-dimethylpropanamide is CN(C)C(=O)C(N)CC1CCCCC1.
What is the InChIKey of 2-amino-3-cyclohexyl-N,N-dimethylpropanamide?
The InChIKey is UNYPVAVUPQIZTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-13(2)11(14)10(12)8-9-6-4-3-5-7-9/h9-10H,3-8,12H2,1-2H3.
What are the key properties of 2-amino-3-cyclohexyl-N,N-dimethylpropanamide?
2-amino-3-cyclohexyl-N,N-dimethylpropanamide has a molecular weight of 198.31 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-cyclohexyl-N,N-dimethylpropanamide is sourced from PubChem (CID 83618462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).