C9H18N2O — CID 68552101
(2S)-2-amino-2-cyclopentyl-N,N-dimethylacetamide (PubChem CID 68552101) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (2S)-2-amino-2-cyclopentyl-N,N-dimethylacetamide.
| Compound Name | (2S)-2-amino-2-cyclopentyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 68552101 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (2S)-2-amino-2-cyclopentyl-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)[C@@H](N)C1CCCC1 |
| InChI | InChI=1S/C9H18N2O/c1-11(2)9(12)8(10)7-5-3-4-6-7/h7-8H,3-6,10H2,1-2H3/t8-/m0/s1 |
| InChIKey | OKKUWKBWPPNOFL-QMMMGPOBSA-N |
| XLogP | 0.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |