C12H23NO2 — CID 14930114
(2R,3R)-3-cyclohexyl-3-hydroxy-N,N,2-trimethylpropanamide (PubChem CID 14930114) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (2R,3R)-3-cyclohexyl-3-hydroxy-N,N,2-trimethylpropanamide.
| Compound Name | (2R,3R)-3-cyclohexyl-3-hydroxy-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 14930114 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (2R,3R)-3-cyclohexyl-3-hydroxy-N,N,2-trimethylpropanamide |
| SMILES | C[C@@H](C(=O)N(C)C)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C12H23NO2/c1-9(12(15)13(2)3)11(14)10-7-5-4-6-8-10/h9-11,14H,4-8H2,1-3H3/t9-,11+/m1/s1 |
| InChIKey | FFLXGTSHTCTHAN-KOLCDFICSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |