About 2-cyclohexylpropanoyl 2-cyclohexylpropanoate
2-cyclohexylpropanoyl 2-cyclohexylpropanoate (PubChem CID 88630041) has the molecular formula C18H30O3
and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-cyclohexylpropanoyl 2-cyclohexylpropanoate.
Molecular Properties
| Compound Name | 2-cyclohexylpropanoyl 2-cyclohexylpropanoate |
| PubChem CID | 88630041 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-cyclohexylpropanoyl 2-cyclohexylpropanoate |
| SMILES | CC(C(=O)OC(=O)C(C)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H30O3/c1-13(15-9-5-3-6-10-15)17(19)21-18(20)14(2)16-11-7-4-8-12-16/h13-16H,3-12H2,1-2H3 |
| InChIKey | BZLFQTDVGFRDIU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylpropanoyl 2-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpropanoyl 2-cyclohexylpropanoate?
The IUPAC name of 2-cyclohexylpropanoyl 2-cyclohexylpropanoate (CID 88630041) is 2-cyclohexylpropanoyl 2-cyclohexylpropanoate.
What is the SMILES notation for 2-cyclohexylpropanoyl 2-cyclohexylpropanoate?
The canonical SMILES for 2-cyclohexylpropanoyl 2-cyclohexylpropanoate is CC(C(=O)OC(=O)C(C)C1CCCCC1)C1CCCCC1.
What is the InChIKey of 2-cyclohexylpropanoyl 2-cyclohexylpropanoate?
The InChIKey is BZLFQTDVGFRDIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O3/c1-13(15-9-5-3-6-10-15)17(19)21-18(20)14(2)16-11-7-4-8-12-16/h13-16H,3-12H2,1-2H3.
What are the key properties of 2-cyclohexylpropanoyl 2-cyclohexylpropanoate?
2-cyclohexylpropanoyl 2-cyclohexylpropanoate has a molecular weight of 294.44 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpropanoyl 2-cyclohexylpropanoate is sourced from PubChem (CID 88630041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).