About 2-cyclopentylpropanoyl chloride
2-cyclopentylpropanoyl chloride (PubChem CID 18426767) has the molecular formula C8H13ClO
and a molecular weight of 160.64 g/mol. Its IUPAC name is 2-cyclopentylpropanoyl chloride.
Molecular Properties
| Compound Name | 2-cyclopentylpropanoyl chloride |
| PubChem CID | 18426767 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-cyclopentylpropanoyl chloride |
| SMILES | CC(C(=O)Cl)C1CCCC1 |
| InChI | InChI=1S/C8H13ClO/c1-6(8(9)10)7-4-2-3-5-7/h6-7H,2-5H2,1H3 |
| InChIKey | PFSLCDNYNJTYDO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentylpropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylpropanoyl chloride?
The IUPAC name of 2-cyclopentylpropanoyl chloride (CID 18426767) is 2-cyclopentylpropanoyl chloride.
What is the SMILES notation for 2-cyclopentylpropanoyl chloride?
The canonical SMILES for 2-cyclopentylpropanoyl chloride is CC(C(=O)Cl)C1CCCC1.
What is the InChIKey of 2-cyclopentylpropanoyl chloride?
The InChIKey is PFSLCDNYNJTYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO/c1-6(8(9)10)7-4-2-3-5-7/h6-7H,2-5H2,1H3.
What are the key properties of 2-cyclopentylpropanoyl chloride?
2-cyclopentylpropanoyl chloride has a molecular weight of 160.64 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylpropanoyl chloride is sourced from PubChem (CID 18426767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).